C23H23N3O4S — CID 55377318
2-(4-acetamidophenyl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]acetamide (PubChem CID 55377318) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]acetamide.
| Compound Name | 2-(4-acetamidophenyl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 55377318 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-(4-acetamidophenyl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CC(=O)Nc2ccc(NS(=O)(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C23H23N3O4S/c1-16-3-13-22(14-4-16)31(29,30)26-21-11-9-20(10-12-21)25-23(28)15-18-5-7-19(8-6-18)24-17(2)27/h3-14,26H,15H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | MJPXCOAMFJFJKH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |