C26H21BrN2O3S — CID 100515533
N-[4-[(4-bromophenyl)sulfamoyl]phenyl]-2-(4-phenylphenyl)acetamide (PubChem CID 100515533) has the molecular formula C26H21BrN2O3S and a molecular weight of 521.44 g/mol. Its IUPAC name is N-[4-[(4-bromophenyl)sulfamoyl]phenyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[4-[(4-bromophenyl)sulfamoyl]phenyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 100515533 |
| Molecular Formula | C26H21BrN2O3S |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | N-[4-[(4-bromophenyl)sulfamoyl]phenyl]-2-(4-phenylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)Nc1ccc(S(=O)(=O)Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C26H21BrN2O3S/c27-22-10-12-24(13-11-22)29-33(31,32)25-16-14-23(15-17-25)28-26(30)18-19-6-8-21(9-7-19)20-4-2-1-3-5-20/h1-17,29H,18H2,(H,28,30) |
| InChIKey | LLESRKQMVOPTFE-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |