C26H22BrN3O3S — CID 176892877
N-benzyl-2-[5-[4-[(4-bromophenyl)sulfonylamino]phenyl]-2-pyridinyl]acetamide (PubChem CID 176892877) has the molecular formula C26H22BrN3O3S and a molecular weight of 536.45 g/mol. Its IUPAC name is N-benzyl-2-[5-[4-[(4-bromophenyl)sulfonylamino]phenyl]-2-pyridinyl]acetamide.
| Compound Name | N-benzyl-2-[5-[4-[(4-bromophenyl)sulfonylamino]phenyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 176892877 |
| Molecular Formula | C26H22BrN3O3S |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | N-benzyl-2-[5-[4-[(4-bromophenyl)sulfonylamino]phenyl]-2-pyridinyl]acetamide |
| SMILES | O=C(Cc1ccc(-c2ccc(NS(=O)(=O)c3ccc(Br)cc3)cc2)cn1)NCc1ccccc1 |
| InChI | InChI=1S/C26H22BrN3O3S/c27-22-9-14-25(15-10-22)34(32,33)30-23-11-6-20(7-12-23)21-8-13-24(28-18-21)16-26(31)29-17-19-4-2-1-3-5-19/h1-15,18,30H,16-17H2,(H,29,31) |
| InChIKey | XAMUULRLHVQPSL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |