C28H33N3O3 — CID 166626298
N-benzyl-2-[5-[4-(4-morpholin-4-ylbutoxy)phenyl]-2-pyridinyl]acetamide (PubChem CID 166626298) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-benzyl-2-[5-[4-(4-morpholin-4-ylbutoxy)phenyl]-2-pyridinyl]acetamide.
| Compound Name | N-benzyl-2-[5-[4-(4-morpholin-4-ylbutoxy)phenyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 166626298 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | N-benzyl-2-[5-[4-(4-morpholin-4-ylbutoxy)phenyl]-2-pyridinyl]acetamide |
| SMILES | O=C(Cc1ccc(-c2ccc(OCCCCN3CCOCC3)cc2)cn1)NCc1ccccc1 |
| InChI | InChI=1S/C28H33N3O3/c32-28(30-21-23-6-2-1-3-7-23)20-26-11-8-25(22-29-26)24-9-12-27(13-10-24)34-17-5-4-14-31-15-18-33-19-16-31/h1-3,6-13,22H,4-5,14-21H2,(H,30,32) |
| InChIKey | CJWVPAGYDBUSIS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|