C28H32F2N4O2 — CID 59000676
N-[[3-fluoro-5-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]methyl]-2-[5-(4-fluorophenyl)-2-pyridinyl]acetamide (PubChem CID 59000676) has the molecular formula C28H32F2N4O2 and a molecular weight of 494.59 g/mol. Its IUPAC name is N-[[3-fluoro-5-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]methyl]-2-[5-(4-fluorophenyl)-2-pyridinyl]acetamide.
| Compound Name | N-[[3-fluoro-5-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]methyl]-2-[5-(4-fluorophenyl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 59000676 |
| Molecular Formula | C28H32F2N4O2 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | N-[[3-fluoro-5-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]methyl]-2-[5-(4-fluorophenyl)-2-pyridinyl]acetamide |
| SMILES | CN1CCN(CCCOc2cc(F)cc(CNC(=O)Cc3ccc(-c4ccc(F)cc4)cn3)c2)CC1 |
| InChI | InChI=1S/C28H32F2N4O2/c1-33-10-12-34(13-11-33)9-2-14-36-27-16-21(15-25(30)17-27)19-32-28(35)18-26-8-5-23(20-31-26)22-3-6-24(29)7-4-22/h3-8,15-17,20H,2,9-14,18-19H2,1H3,(H,32,35) |
| InChIKey | QTHVUKOCYRLPBA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|