C28H32FN3O2 — CID 59000643
N-[(3-fluorophenyl)methyl]-2-[5-[4-(3-piperidin-1-ylpropoxy)phenyl]-2-pyridinyl]acetamide (PubChem CID 59000643) has the molecular formula C28H32FN3O2 and a molecular weight of 461.58 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-2-[5-[4-(3-piperidin-1-ylpropoxy)phenyl]-2-pyridinyl]acetamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-2-[5-[4-(3-piperidin-1-ylpropoxy)phenyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 59000643 |
| Molecular Formula | C28H32FN3O2 |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-2-[5-[4-(3-piperidin-1-ylpropoxy)phenyl]-2-pyridinyl]acetamide |
| SMILES | O=C(Cc1ccc(-c2ccc(OCCCN3CCCCC3)cc2)cn1)NCc1cccc(F)c1 |
| InChI | InChI=1S/C28H32FN3O2/c29-25-7-4-6-22(18-25)20-31-28(33)19-26-11-8-24(21-30-26)23-9-12-27(13-10-23)34-17-5-16-32-14-2-1-3-15-32/h4,6-13,18,21H,1-3,5,14-17,19-20H2,(H,31,33) |
| InChIKey | LFLNEWVHWPALHN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|