C24H24F2N2O3 — CID 70934294
2-[5-[2-fluoro-4-(3-methoxypropoxy)phenyl]-2-pyridinyl]-N-[(3-fluorophenyl)methyl]acetamide (PubChem CID 70934294) has the molecular formula C24H24F2N2O3 and a molecular weight of 426.46 g/mol. Its IUPAC name is 2-[5-[2-fluoro-4-(3-methoxypropoxy)phenyl]-2-pyridinyl]-N-[(3-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[5-[2-fluoro-4-(3-methoxypropoxy)phenyl]-2-pyridinyl]-N-[(3-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 70934294 |
| Molecular Formula | C24H24F2N2O3 |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-[5-[2-fluoro-4-(3-methoxypropoxy)phenyl]-2-pyridinyl]-N-[(3-fluorophenyl)methyl]acetamide |
| SMILES | COCCCOc1ccc(-c2ccc(CC(=O)NCc3cccc(F)c3)nc2)c(F)c1 |
| InChI | InChI=1S/C24H24F2N2O3/c1-30-10-3-11-31-21-8-9-22(23(26)14-21)18-6-7-20(27-16-18)13-24(29)28-15-17-4-2-5-19(25)12-17/h2,4-9,12,14,16H,3,10-11,13,15H2,1H3,(H,28,29) |
| InChIKey | YLDPUXLCKDTOCZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|