C25H24F2N2O3 — CID 59508388
2-[4-(2-fluoro-4-morpholin-4-yloxyphenyl)phenyl]-N-[(3-fluorophenyl)methyl]acetamide (PubChem CID 59508388) has the molecular formula C25H24F2N2O3 and a molecular weight of 438.47 g/mol. Its IUPAC name is 2-[4-(2-fluoro-4-morpholin-4-yloxyphenyl)phenyl]-N-[(3-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[4-(2-fluoro-4-morpholin-4-yloxyphenyl)phenyl]-N-[(3-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 59508388 |
| Molecular Formula | C25H24F2N2O3 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-[4-(2-fluoro-4-morpholin-4-yloxyphenyl)phenyl]-N-[(3-fluorophenyl)methyl]acetamide |
| SMILES | O=C(Cc1ccc(-c2ccc(ON3CCOCC3)cc2F)cc1)NCc1cccc(F)c1 |
| InChI | InChI=1S/C25H24F2N2O3/c26-21-3-1-2-19(14-21)17-28-25(30)15-18-4-6-20(7-5-18)23-9-8-22(16-24(23)27)32-29-10-12-31-13-11-29/h1-9,14,16H,10-13,15,17H2,(H,28,30) |
| InChIKey | GWPMXQXXEOBODZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |