C22H22FN2O3+ — CID 59000647
2-[6-(4-ethoxyphenyl)-1-hydroxypyridin-1-ium-3-yl]-N-[(3-fluorophenyl)methyl]acetamide (PubChem CID 59000647) has the molecular formula C22H22FN2O3+ and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-[6-(4-ethoxyphenyl)-1-hydroxypyridin-1-ium-3-yl]-N-[(3-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[6-(4-ethoxyphenyl)-1-hydroxypyridin-1-ium-3-yl]-N-[(3-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 59000647 |
| Molecular Formula | C22H22FN2O3+ |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-[6-(4-ethoxyphenyl)-1-hydroxypyridin-1-ium-3-yl]-N-[(3-fluorophenyl)methyl]acetamide |
| SMILES | CCOc1ccc(-c2ccc(CC(=O)NCc3cccc(F)c3)c[n+]2O)cc1 |
| InChI | InChI=1S/C22H21FN2O3/c1-2-28-20-9-7-18(8-10-20)21-11-6-17(15-25(21)27)13-22(26)24-14-16-4-3-5-19(23)12-16/h3-12,15H,2,13-14H2,1H3,(H-,24,26,27)/p+1 |
| InChIKey | DHKRUWTYVZFANQ-UHFFFAOYSA-O |
| XLogP | 3.28 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|