C31H40FN3O4 — CID 143708346
ethane;2-[5-(4-ethoxyphenyl)-2-pyridinyl]-N-[[3-fluoro-5-(3-morpholin-4-ylpropoxy)phenyl]methyl]acetamide (PubChem CID 143708346) has the molecular formula C31H40FN3O4 and a molecular weight of 537.68 g/mol. Its IUPAC name is ethane;2-[5-(4-ethoxyphenyl)-2-pyridinyl]-N-[[3-fluoro-5-(3-morpholin-4-ylpropoxy)phenyl]methyl]acetamide.
| Compound Name | ethane;2-[5-(4-ethoxyphenyl)-2-pyridinyl]-N-[[3-fluoro-5-(3-morpholin-4-ylpropoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 143708346 |
| Molecular Formula | C31H40FN3O4 |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | ethane;2-[5-(4-ethoxyphenyl)-2-pyridinyl]-N-[[3-fluoro-5-(3-morpholin-4-ylpropoxy)phenyl]methyl]acetamide |
| SMILES | CC.CCOc1ccc(-c2ccc(CC(=O)NCc3cc(F)cc(OCCCN4CCOCC4)c3)nc2)cc1 |
| InChI | InChI=1S/C29H34FN3O4.C2H6/c1-2-36-27-8-5-23(6-9-27)24-4-7-26(31-21-24)19-29(34)32-20-22-16-25(30)18-28(17-22)37-13-3-10-33-11-14-35-15-12-33;1-2/h4-9,16-18,21H,2-3,10-15,19-20H2,1H3,(H,32,34);1-2H3 |
| InChIKey | YADLVJXDZZZBOE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|