C25H25N3O4 — CID 176892887
5-[4-[6-[2-(benzylamino)-2-oxoethyl]-3-pyridinyl]anilino]-5-oxopentanoic acid (PubChem CID 176892887) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is 5-[4-[6-[2-(benzylamino)-2-oxoethyl]-3-pyridinyl]anilino]-5-oxopentanoic acid.
| Compound Name | 5-[4-[6-[2-(benzylamino)-2-oxoethyl]-3-pyridinyl]anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 176892887 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 5-[4-[6-[2-(benzylamino)-2-oxoethyl]-3-pyridinyl]anilino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)Nc1ccc(-c2ccc(CC(=O)NCc3ccccc3)nc2)cc1 |
| InChI | InChI=1S/C25H25N3O4/c29-23(7-4-8-25(31)32)28-21-12-9-19(10-13-21)20-11-14-22(26-17-20)15-24(30)27-16-18-5-2-1-3-6-18/h1-3,5-6,9-14,17H,4,7-8,15-16H2,(H,27,30)(H,28,29)(H,31,32) |
| InChIKey | UHMWBZRHSGDRBD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |