C17H17FN2O4S2 — CID 4786491
N-[4-(acetylsulfamoyl)phenyl]-2-[(4-fluorophenyl)methylsulfanyl]acetamide (PubChem CID 4786491) has the molecular formula C17H17FN2O4S2 and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)phenyl]-2-[(4-fluorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[4-(acetylsulfamoyl)phenyl]-2-[(4-fluorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 4786491 |
| Molecular Formula | C17H17FN2O4S2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | N-[4-(acetylsulfamoyl)phenyl]-2-[(4-fluorophenyl)methylsulfanyl]acetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)CSCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H17FN2O4S2/c1-12(21)20-26(23,24)16-8-6-15(7-9-16)19-17(22)11-25-10-13-2-4-14(18)5-3-13/h2-9H,10-11H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | CWYRRVAGMVIFFR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |