C18H16FN3O4S — CID 29136353
N-[4-(acetylsulfamoyl)phenyl]-2-(6-fluoroindol-1-yl)acetamide (PubChem CID 29136353) has the molecular formula C18H16FN3O4S and a molecular weight of 389.41 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)phenyl]-2-(6-fluoroindol-1-yl)acetamide.
| Compound Name | N-[4-(acetylsulfamoyl)phenyl]-2-(6-fluoroindol-1-yl)acetamide |
|---|---|
| PubChem CID | 29136353 |
| Molecular Formula | C18H16FN3O4S |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | N-[4-(acetylsulfamoyl)phenyl]-2-(6-fluoroindol-1-yl)acetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)Cn2ccc3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C18H16FN3O4S/c1-12(23)21-27(25,26)16-6-4-15(5-7-16)20-18(24)11-22-9-8-13-2-3-14(19)10-17(13)22/h2-10H,11H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | KYWKLEUVQRORGX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |