C23H23FN2O4S2 — CID 92677412
N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2-[(4-fluorophenyl)methylsulfanyl]acetamide (PubChem CID 92677412) has the molecular formula C23H23FN2O4S2 and a molecular weight of 474.58 g/mol. Its IUPAC name is N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2-[(4-fluorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2-[(4-fluorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 92677412 |
| Molecular Formula | C23H23FN2O4S2 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-2-[(4-fluorophenyl)methylsulfanyl]acetamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NC(=O)CSCc3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C23H23FN2O4S2/c1-2-30-21-11-7-20(8-12-21)26-32(28,29)22-13-9-19(10-14-22)25-23(27)16-31-15-17-3-5-18(24)6-4-17/h3-14,26H,2,15-16H2,1H3,(H,25,27) |
| InChIKey | MLHLKSHATHTFEV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |