C20H16FIN2O4S — CID 126396397
2-[4-[(4-fluorophenyl)sulfamoyl]phenoxy]-N-(4-iodophenyl)acetamide (PubChem CID 126396397) has the molecular formula C20H16FIN2O4S and a molecular weight of 526.33 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)sulfamoyl]phenoxy]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[4-[(4-fluorophenyl)sulfamoyl]phenoxy]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 126396397 |
| Molecular Formula | C20H16FIN2O4S |
| Molecular Weight | 526.33 g/mol |
| Exact Mass | 525.99 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)sulfamoyl]phenoxy]-N-(4-iodophenyl)acetamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C20H16FIN2O4S/c21-14-1-5-17(6-2-14)24-29(26,27)19-11-9-18(10-12-19)28-13-20(25)23-16-7-3-15(22)4-8-16/h1-12,24H,13H2,(H,23,25) |
| InChIKey | OWVOVIUGEMWAAP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|