C14H12FIN2O3S — CID 126134237
2-[(4-fluorophenyl)sulfonylamino]-N-(4-iodophenyl)acetamide (PubChem CID 126134237) has the molecular formula C14H12FIN2O3S and a molecular weight of 434.23 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonylamino]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[(4-fluorophenyl)sulfonylamino]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 126134237 |
| Molecular Formula | C14H12FIN2O3S |
| Molecular Weight | 434.23 g/mol |
| Exact Mass | 433.96 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonylamino]-N-(4-iodophenyl)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(F)cc1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C14H12FIN2O3S/c15-10-1-7-13(8-2-10)22(20,21)17-9-14(19)18-12-5-3-11(16)4-6-12/h1-8,17H,9H2,(H,18,19) |
| InChIKey | ICZNWSGUUFIFPQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|