C8H7FNO4S- — CID 3258763
2-[(4-fluorophenyl)sulfonylamino]acetate (PubChem CID 3258763) has the molecular formula C8H7FNO4S- and a molecular weight of 232.21 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonylamino]acetate.
| Compound Name | 2-[(4-fluorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 3258763 |
| Molecular Formula | C8H7FNO4S- |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonylamino]acetate |
| SMILES | O=C([O-])CNS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C8H8FNO4S/c9-6-1-3-7(4-2-6)15(13,14)10-5-8(11)12/h1-4,10H,5H2,(H,11,12)/p-1 |
| InChIKey | XAEAUZAGDOXYIE-UHFFFAOYSA-M |
| XLogP | -1.15 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |