C15H15FN2O4S — CID 9495477
2-[(4-fluorophenyl)sulfonylamino]-N-(2-hydroxy-4-methylphenyl)acetamide (PubChem CID 9495477) has the molecular formula C15H15FN2O4S and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonylamino]-N-(2-hydroxy-4-methylphenyl)acetamide.
| Compound Name | 2-[(4-fluorophenyl)sulfonylamino]-N-(2-hydroxy-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 9495477 |
| Molecular Formula | C15H15FN2O4S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonylamino]-N-(2-hydroxy-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CNS(=O)(=O)c2ccc(F)cc2)c(O)c1 |
| InChI | InChI=1S/C15H15FN2O4S/c1-10-2-7-13(14(19)8-10)18-15(20)9-17-23(21,22)12-5-3-11(16)4-6-12/h2-8,17,19H,9H2,1H3,(H,18,20) |
| InChIKey | ZYAMSBLLFBJBQX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|