C14H12F3N3O3S — CID 166200572
N-[2-[2-(2,4-difluorophenyl)hydrazinyl]-2-oxoethyl]-4-fluorobenzenesulfonamide (PubChem CID 166200572) has the molecular formula C14H12F3N3O3S and a molecular weight of 359.33 g/mol. Its IUPAC name is N-[2-[2-(2,4-difluorophenyl)hydrazinyl]-2-oxoethyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-[2-(2,4-difluorophenyl)hydrazinyl]-2-oxoethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 166200572 |
| Molecular Formula | C14H12F3N3O3S |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-[2-[2-(2,4-difluorophenyl)hydrazinyl]-2-oxoethyl]-4-fluorobenzenesulfonamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(F)cc1)NNc1ccc(F)cc1F |
| InChI | InChI=1S/C14H12F3N3O3S/c15-9-1-4-11(5-2-9)24(22,23)18-8-14(21)20-19-13-6-3-10(16)7-12(13)17/h1-7,18-19H,8H2,(H,20,21) |
| InChIKey | DWTKSHKADDRRLK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|