C19H23N3O5S — CID 7979655
2-[[2-[(3,4-dimethylphenyl)sulfonylamino]acetyl]amino]-N-(2-hydroxy-4-methylphenyl)acetamide (PubChem CID 7979655) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-[[2-[(3,4-dimethylphenyl)sulfonylamino]acetyl]amino]-N-(2-hydroxy-4-methylphenyl)acetamide.
| Compound Name | 2-[[2-[(3,4-dimethylphenyl)sulfonylamino]acetyl]amino]-N-(2-hydroxy-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 7979655 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2-[[2-[(3,4-dimethylphenyl)sulfonylamino]acetyl]amino]-N-(2-hydroxy-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CNC(=O)CNS(=O)(=O)c2ccc(C)c(C)c2)c(O)c1 |
| InChI | InChI=1S/C19H23N3O5S/c1-12-4-7-16(17(23)8-12)22-19(25)10-20-18(24)11-21-28(26,27)15-6-5-13(2)14(3)9-15/h4-9,21,23H,10-11H2,1-3H3,(H,20,24)(H,22,25) |
| InChIKey | DVBZPOKFLCXOSX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|