C19H24N2O4S — CID 51166424
N-(2-hydroxy-4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide (PubChem CID 51166424) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-(2-hydroxy-4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide.
| Compound Name | N-(2-hydroxy-4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 51166424 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-(2-hydroxy-4-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCCC(=O)Nc2ccc(C)cc2O)c(C)c1 |
| InChI | InChI=1S/C19H24N2O4S/c1-12-5-6-16(17(22)11-12)21-18(23)7-8-20-26(24,25)19-14(3)9-13(2)10-15(19)4/h5-6,9-11,20,22H,7-8H2,1-4H3,(H,21,23) |
| InChIKey | OOFFWGSSASYVNO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|