C19H25N3O3S — CID 120569314
N-(5-amino-2-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide (PubChem CID 120569314) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide.
| Compound Name | N-(5-amino-2-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 120569314 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCCC(=O)Nc2cc(N)ccc2C)c(C)c1 |
| InChI | InChI=1S/C19H25N3O3S/c1-12-9-14(3)19(15(4)10-12)26(24,25)21-8-7-18(23)22-17-11-16(20)6-5-13(17)2/h5-6,9-11,21H,7-8,20H2,1-4H3,(H,22,23) |
| InChIKey | VBABAVNQTISBKS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|