C14H23ClN2O — CID 120569223
N-(5-amino-2-methylphenyl)-4,4-dimethylpentanamide;hydrochloride (PubChem CID 120569223) has the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-4,4-dimethylpentanamide;hydrochloride.
| Compound Name | N-(5-amino-2-methylphenyl)-4,4-dimethylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 120569223 |
| Molecular Formula | C14H23ClN2O |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-4,4-dimethylpentanamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1NC(=O)CCC(C)(C)C.Cl |
| InChI | InChI=1S/C14H22N2O.ClH/c1-10-5-6-11(15)9-12(10)16-13(17)7-8-14(2,3)4;/h5-6,9H,7-8,15H2,1-4H3,(H,16,17);1H |
| InChIKey | RWGAAJMZQVJZQN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|