C15H24N2O — CID 114212732
N-(4-amino-2,5-dimethylphenyl)-4,4-dimethylpentanamide (PubChem CID 114212732) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is N-(4-amino-2,5-dimethylphenyl)-4,4-dimethylpentanamide.
| Compound Name | N-(4-amino-2,5-dimethylphenyl)-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 114212732 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | N-(4-amino-2,5-dimethylphenyl)-4,4-dimethylpentanamide |
| SMILES | Cc1cc(NC(=O)CCC(C)(C)C)c(C)cc1N |
| InChI | InChI=1S/C15H24N2O/c1-10-9-13(11(2)8-12(10)16)17-14(18)6-7-15(3,4)5/h8-9H,6-7,16H2,1-5H3,(H,17,18) |
| InChIKey | BJKVDIKMPMGOSP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|