About N-(4-amino-2,5-dimethylphenyl)-2-methyl-2-phenylpropanamide
N-(4-amino-2,5-dimethylphenyl)-2-methyl-2-phenylpropanamide (PubChem CID 103144554) has the molecular formula C18H22N2O
and a molecular weight of 282.39 g/mol. Its IUPAC name is N-(4-amino-2,5-dimethylphenyl)-2-methyl-2-phenylpropanamide.
Molecular Properties
| Compound Name | N-(4-amino-2,5-dimethylphenyl)-2-methyl-2-phenylpropanamide |
| PubChem CID | 103144554 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-(4-amino-2,5-dimethylphenyl)-2-methyl-2-phenylpropanamide |
| SMILES | Cc1cc(NC(=O)C(C)(C)c2ccccc2)c(C)cc1N |
| InChI | InChI=1S/C18H22N2O/c1-12-11-16(13(2)10-15(12)19)20-17(21)18(3,4)14-8-6-5-7-9-14/h5-11H,19H2,1-4H3,(H,20,21) |
| InChIKey | QZIVKKDUZKHKCV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(4-amino-2,5-dimethylphenyl)-2-methyl-2-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-2,5-dimethylphenyl)-2-methyl-2-phenylpropanamide?
The IUPAC name of N-(4-amino-2,5-dimethylphenyl)-2-methyl-2-phenylpropanamide (CID 103144554) is N-(4-amino-2,5-dimethylphenyl)-2-methyl-2-phenylpropanamide.
What is the SMILES notation for N-(4-amino-2,5-dimethylphenyl)-2-methyl-2-phenylpropanamide?
The canonical SMILES for N-(4-amino-2,5-dimethylphenyl)-2-methyl-2-phenylpropanamide is Cc1cc(NC(=O)C(C)(C)c2ccccc2)c(C)cc1N.
What is the InChIKey of N-(4-amino-2,5-dimethylphenyl)-2-methyl-2-phenylpropanamide?
The InChIKey is QZIVKKDUZKHKCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O/c1-12-11-16(13(2)10-15(12)19)20-17(21)18(3,4)14-8-6-5-7-9-14/h5-11H,19H2,1-4H3,(H,20,21).
What are the key properties of N-(4-amino-2,5-dimethylphenyl)-2-methyl-2-phenylpropanamide?
N-(4-amino-2,5-dimethylphenyl)-2-methyl-2-phenylpropanamide has a molecular weight of 282.39 g/mol, XLogP of 3.80, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-2,5-dimethylphenyl)-2-methyl-2-phenylpropanamide is sourced from PubChem (CID 103144554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).