About N-(4-amino-2,5-dimethylphenyl)-2,2-dimethylbutanamide
N-(4-amino-2,5-dimethylphenyl)-2,2-dimethylbutanamide (PubChem CID 103144437) has the molecular formula C14H22N2O
and a molecular weight of 234.34 g/mol. Its IUPAC name is N-(4-amino-2,5-dimethylphenyl)-2,2-dimethylbutanamide.
Molecular Properties
| Compound Name | N-(4-amino-2,5-dimethylphenyl)-2,2-dimethylbutanamide |
| PubChem CID | 103144437 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N-(4-amino-2,5-dimethylphenyl)-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1cc(C)c(N)cc1C |
| InChI | InChI=1S/C14H22N2O/c1-6-14(4,5)13(17)16-12-8-9(2)11(15)7-10(12)3/h7-8H,6,15H2,1-5H3,(H,16,17) |
| InChIKey | RZTVSJRDKIULGF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(4-amino-2,5-dimethylphenyl)-2,2-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-2,5-dimethylphenyl)-2,2-dimethylbutanamide?
The IUPAC name of N-(4-amino-2,5-dimethylphenyl)-2,2-dimethylbutanamide (CID 103144437) is N-(4-amino-2,5-dimethylphenyl)-2,2-dimethylbutanamide.
What is the SMILES notation for N-(4-amino-2,5-dimethylphenyl)-2,2-dimethylbutanamide?
The canonical SMILES for N-(4-amino-2,5-dimethylphenyl)-2,2-dimethylbutanamide is CCC(C)(C)C(=O)Nc1cc(C)c(N)cc1C.
What is the InChIKey of N-(4-amino-2,5-dimethylphenyl)-2,2-dimethylbutanamide?
The InChIKey is RZTVSJRDKIULGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O/c1-6-14(4,5)13(17)16-12-8-9(2)11(15)7-10(12)3/h7-8H,6,15H2,1-5H3,(H,16,17).
What are the key properties of N-(4-amino-2,5-dimethylphenyl)-2,2-dimethylbutanamide?
N-(4-amino-2,5-dimethylphenyl)-2,2-dimethylbutanamide has a molecular weight of 234.34 g/mol, XLogP of 3.26, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-2,5-dimethylphenyl)-2,2-dimethylbutanamide is sourced from PubChem (CID 103144437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).