C18H28N2O2 — CID 151797393
N-[2-amino-4-(3,3-dimethylbutanoyl)phenyl]-2,2-dimethylbutanamide (PubChem CID 151797393) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is N-[2-amino-4-(3,3-dimethylbutanoyl)phenyl]-2,2-dimethylbutanamide.
| Compound Name | N-[2-amino-4-(3,3-dimethylbutanoyl)phenyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 151797393 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | N-[2-amino-4-(3,3-dimethylbutanoyl)phenyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1ccc(C(=O)CC(C)(C)C)cc1N |
| InChI | InChI=1S/C18H28N2O2/c1-7-18(5,6)16(22)20-14-9-8-12(10-13(14)19)15(21)11-17(2,3)4/h8-10H,7,11,19H2,1-6H3,(H,20,22) |
| InChIKey | RXWRHIARIMBLMH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|