C12H14Cl2O — CID 24724011
1-(3,4-dichlorophenyl)-3,3-dimethylbutan-1-one (PubChem CID 24724011) has the molecular formula C12H14Cl2O and a molecular weight of 245.15 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3,3-dimethylbutan-1-one.
| Compound Name | 1-(3,4-dichlorophenyl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 24724011 |
| Molecular Formula | C12H14Cl2O |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2O/c1-12(2,3)7-11(15)8-4-5-9(13)10(14)6-8/h4-6H,7H2,1-3H3 |
| InChIKey | CAFOUHFEDGIZQO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |