C12H12Cl2O3 — CID 26595905
(3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid (PubChem CID 26595905) has the molecular formula C12H12Cl2O3 and a molecular weight of 275.13 g/mol. Its IUPAC name is (3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid.
| Compound Name | (3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 26595905 |
| Molecular Formula | C12H12Cl2O3 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | (3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid |
| SMILES | C[C@@H](CC(=O)O)CC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2O3/c1-7(5-12(16)17)4-11(15)8-2-3-9(13)10(14)6-8/h2-3,6-7H,4-5H2,1H3,(H,16,17)/t7-/m1/s1 |
| InChIKey | ZTILJBHQENWYQA-SSDOTTSWSA-N |
| XLogP | 3.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |