(3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid

C12H12Cl2O3 — CID 26595905

IUPAC(3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid
SMILESC[C@@H](CC(=O)O)CC(=O)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C12H12Cl2O3/c1-7(5-12(16)17)4-11(15)8-2-3-9(13)10(14)6-8/h2-3,6-7H,4-5H2,1H3,(H,16,17)/t7-/m1/s1
InChIKeyZTILJBHQENWYQA-SSDOTTSWSA-N
MW275.13 g/mol
LogP3.68
Rot. Bonds5

About (3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid

(3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid (PubChem CID 26595905) has the molecular formula C12H12Cl2O3 and a molecular weight of 275.13 g/mol. Its IUPAC name is (3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid.

Molecular Properties

Compound Name(3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid
PubChem CID26595905
Molecular FormulaC12H12Cl2O3
Molecular Weight275.13 g/mol
Exact Mass274.02
IUPAC Name(3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid
SMILESC[C@@H](CC(=O)O)CC(=O)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C12H12Cl2O3/c1-7(5-12(16)17)4-11(15)8-2-3-9(13)10(14)6-8/h2-3,6-7H,4-5H2,1H3,(H,16,17)/t7-/m1/s1
InChIKeyZTILJBHQENWYQA-SSDOTTSWSA-N
XLogP3.68
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.13
LogP ≤ 53.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid?
The IUPAC name of (3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid (CID 26595905) is (3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid.
What is the SMILES notation for (3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid?
The canonical SMILES for (3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid is C[C@@H](CC(=O)O)CC(=O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid?
The InChIKey is ZTILJBHQENWYQA-SSDOTTSWSA-N. The full InChI is InChI=1S/C12H12Cl2O3/c1-7(5-12(16)17)4-11(15)8-2-3-9(13)10(14)6-8/h2-3,6-7H,4-5H2,1H3,(H,16,17)/t7-/m1/s1.
What are the key properties of (3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid?
(3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid has a molecular weight of 275.13 g/mol, XLogP of 3.68, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5-(3,4-dichlorophenyl)-3-methyl-5-oxopentanoic acid is sourced from PubChem (CID 26595905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).