About (2R)-4-(3,4-dichlorophenyl)-2-methanethioyl-4-oxobutanoic acid
(2R)-4-(3,4-dichlorophenyl)-2-methanethioyl-4-oxobutanoic acid (PubChem CID 20708488) has the molecular formula C11H8Cl2O3S
and a molecular weight of 291.16 g/mol. Its IUPAC name is (2R)-4-(3,4-dichlorophenyl)-2-methanethioyl-4-oxobutanoic acid.
Molecular Properties
| Compound Name | (2R)-4-(3,4-dichlorophenyl)-2-methanethioyl-4-oxobutanoic acid |
| PubChem CID | 20708488 |
| Molecular Formula | C11H8Cl2O3S |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 289.96 |
| IUPAC Name | (2R)-4-(3,4-dichlorophenyl)-2-methanethioyl-4-oxobutanoic acid |
| SMILES | O=C(C[C@@H](C=S)C(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H8Cl2O3S/c12-8-2-1-6(3-9(8)13)10(14)4-7(5-17)11(15)16/h1-3,5,7H,4H2,(H,15,16)/t7-/m0/s1 |
| InChIKey | FJUUHOHFEZFASA-ZETCQYMHSA-N |
| XLogP | 3.27 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2R)-4-(3,4-dichlorophenyl)-2-methanethioyl-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-(3,4-dichlorophenyl)-2-methanethioyl-4-oxobutanoic acid?
The IUPAC name of (2R)-4-(3,4-dichlorophenyl)-2-methanethioyl-4-oxobutanoic acid (CID 20708488) is (2R)-4-(3,4-dichlorophenyl)-2-methanethioyl-4-oxobutanoic acid.
What is the SMILES notation for (2R)-4-(3,4-dichlorophenyl)-2-methanethioyl-4-oxobutanoic acid?
The canonical SMILES for (2R)-4-(3,4-dichlorophenyl)-2-methanethioyl-4-oxobutanoic acid is O=C(C[C@@H](C=S)C(=O)O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (2R)-4-(3,4-dichlorophenyl)-2-methanethioyl-4-oxobutanoic acid?
The InChIKey is FJUUHOHFEZFASA-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H8Cl2O3S/c12-8-2-1-6(3-9(8)13)10(14)4-7(5-17)11(15)16/h1-3,5,7H,4H2,(H,15,16)/t7-/m0/s1.
What are the key properties of (2R)-4-(3,4-dichlorophenyl)-2-methanethioyl-4-oxobutanoic acid?
(2R)-4-(3,4-dichlorophenyl)-2-methanethioyl-4-oxobutanoic acid has a molecular weight of 291.16 g/mol, XLogP of 3.27, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-(3,4-dichlorophenyl)-2-methanethioyl-4-oxobutanoic acid is sourced from PubChem (CID 20708488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).