C12H10Cl2O4 — CID 14497460
6-(3,4-dichlorophenyl)-4,6-dioxohexanoic acid (PubChem CID 14497460) has the molecular formula C12H10Cl2O4 and a molecular weight of 289.11 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-4,6-dioxohexanoic acid.
| Compound Name | 6-(3,4-dichlorophenyl)-4,6-dioxohexanoic acid |
|---|---|
| PubChem CID | 14497460 |
| Molecular Formula | C12H10Cl2O4 |
| Molecular Weight | 289.11 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-4,6-dioxohexanoic acid |
| SMILES | O=C(O)CCC(=O)CC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl2O4/c13-9-3-1-7(5-10(9)14)11(16)6-8(15)2-4-12(17)18/h1,3,5H,2,4,6H2,(H,17,18) |
| InChIKey | NWKDMTQNGJMMCX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.11 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|