C14H12Cl2OS — CID 105076244
1-(3,4-dichlorophenyl)-4-thiophen-2-ylbutan-1-one (PubChem CID 105076244) has the molecular formula C14H12Cl2OS and a molecular weight of 299.22 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-(3,4-dichlorophenyl)-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 105076244 |
| Molecular Formula | C14H12Cl2OS |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCc1cccs1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H12Cl2OS/c15-12-7-6-10(9-13(12)16)14(17)5-1-3-11-4-2-8-18-11/h2,4,6-9H,1,3,5H2 |
| InChIKey | ZUJVBPHCGNIOIQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |