C17H20O2S — CID 105097435
1-(4-propan-2-yloxyphenyl)-4-thiophen-2-ylbutan-1-one (PubChem CID 105097435) has the molecular formula C17H20O2S and a molecular weight of 288.41 g/mol. Its IUPAC name is 1-(4-propan-2-yloxyphenyl)-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-(4-propan-2-yloxyphenyl)-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 105097435 |
| Molecular Formula | C17H20O2S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 1-(4-propan-2-yloxyphenyl)-4-thiophen-2-ylbutan-1-one |
| SMILES | CC(C)Oc1ccc(C(=O)CCCc2cccs2)cc1 |
| InChI | InChI=1S/C17H20O2S/c1-13(2)19-15-10-8-14(9-11-15)17(18)7-3-5-16-6-4-12-20-16/h4,6,8-13H,3,5,7H2,1-2H3 |
| InChIKey | ULLKSKOSPOXQTP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |