C12H10Cl2Li2O4 — CID 68875342
CID 68875342 (PubChem CID 68875342) has the molecular formula C12H10Cl2Li2O4 and a molecular weight of 303.00 g/mol.
| Compound Name | CID 68875342 |
|---|---|
| PubChem CID | 68875342 |
| Molecular Formula | C12H10Cl2Li2O4 |
| Molecular Weight | 303.00 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | — |
| SMILES | O=C(O)CCC(=O)C=C(O)c1ccc(Cl)c(Cl)c1.[Li].[Li] |
| InChI | InChI=1S/C12H10Cl2O4.2Li/c13-9-3-1-7(5-10(9)14)11(16)6-8(15)2-4-12(17)18;;/h1,3,5-6,16H,2,4H2,(H,17,18);; |
| InChIKey | YQGFIKJBBWIKNH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.00 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|