C10H5Cl2F3O2 — CID 7147483
(Z)-4-(3,4-dichlorophenyl)-1,1,1-trifluoro-4-hydroxybut-3-en-2-one (PubChem CID 7147483) has the molecular formula C10H5Cl2F3O2 and a molecular weight of 285.05 g/mol. Its IUPAC name is (Z)-4-(3,4-dichlorophenyl)-1,1,1-trifluoro-4-hydroxybut-3-en-2-one.
| Compound Name | (Z)-4-(3,4-dichlorophenyl)-1,1,1-trifluoro-4-hydroxybut-3-en-2-one |
|---|---|
| PubChem CID | 7147483 |
| Molecular Formula | C10H5Cl2F3O2 |
| Molecular Weight | 285.05 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | (Z)-4-(3,4-dichlorophenyl)-1,1,1-trifluoro-4-hydroxybut-3-en-2-one |
| SMILES | O=C(/C=C(\O)c1ccc(Cl)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C10H5Cl2F3O2/c11-6-2-1-5(3-7(6)12)8(16)4-9(17)10(13,14)15/h1-4,16H/b8-4- |
| InChIKey | SAJWOQIRWDEJJF-YWEYNIOJSA-N |
| XLogP | 4.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.05 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|