C10H6F3NO4 — CID 5347929
(Z)-1,1,1-trifluoro-4-hydroxy-4-(3-nitrophenyl)but-3-en-2-one (PubChem CID 5347929) has the molecular formula C10H6F3NO4 and a molecular weight of 261.15 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-hydroxy-4-(3-nitrophenyl)but-3-en-2-one.
| Compound Name | (Z)-1,1,1-trifluoro-4-hydroxy-4-(3-nitrophenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 5347929 |
| Molecular Formula | C10H6F3NO4 |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-hydroxy-4-(3-nitrophenyl)but-3-en-2-one |
| SMILES | O=C(/C=C(\O)c1cccc([N+](=O)[O-])c1)C(F)(F)F |
| InChI | InChI=1S/C10H6F3NO4/c11-10(12,13)9(16)5-8(15)6-2-1-3-7(4-6)14(17)18/h1-5,15H/b8-5- |
| InChIKey | TUTHFBIQSNYVQU-YVMONPNESA-N |
| XLogP | 2.63 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|