About S-phenyl 3-nitrobenzenecarbothioate
S-phenyl 3-nitrobenzenecarbothioate (PubChem CID 11219131) has the molecular formula C13H9NO3S
and a molecular weight of 259.29 g/mol. Its IUPAC name is S-phenyl 3-nitrobenzenecarbothioate.
Molecular Properties
| Compound Name | S-phenyl 3-nitrobenzenecarbothioate |
| PubChem CID | 11219131 |
| Molecular Formula | C13H9NO3S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | S-phenyl 3-nitrobenzenecarbothioate |
| SMILES | O=C(Sc1ccccc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H9NO3S/c15-13(18-12-7-2-1-3-8-12)10-5-4-6-11(9-10)14(16)17/h1-9H |
| InChIKey | QKPADWKLDRHKNI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenyl 3-nitrobenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenyl 3-nitrobenzenecarbothioate?
The IUPAC name of S-phenyl 3-nitrobenzenecarbothioate (CID 11219131) is S-phenyl 3-nitrobenzenecarbothioate.
What is the SMILES notation for S-phenyl 3-nitrobenzenecarbothioate?
The canonical SMILES for S-phenyl 3-nitrobenzenecarbothioate is O=C(Sc1ccccc1)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of S-phenyl 3-nitrobenzenecarbothioate?
The InChIKey is QKPADWKLDRHKNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3S/c15-13(18-12-7-2-1-3-8-12)10-5-4-6-11(9-10)14(16)17/h1-9H.
What are the key properties of S-phenyl 3-nitrobenzenecarbothioate?
S-phenyl 3-nitrobenzenecarbothioate has a molecular weight of 259.29 g/mol, XLogP of 3.53, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl 3-nitrobenzenecarbothioate is sourced from PubChem (CID 11219131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).