About S-(3-nitrophenyl) N-phenylcarbamothioate
S-(3-nitrophenyl) N-phenylcarbamothioate (PubChem CID 71371517) has the molecular formula C13H10N2O3S
and a molecular weight of 274.30 g/mol. Its IUPAC name is S-(3-nitrophenyl) N-phenylcarbamothioate.
Molecular Properties
| Compound Name | S-(3-nitrophenyl) N-phenylcarbamothioate |
| PubChem CID | 71371517 |
| Molecular Formula | C13H10N2O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | S-(3-nitrophenyl) N-phenylcarbamothioate |
| SMILES | O=C(Nc1ccccc1)Sc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10N2O3S/c16-13(14-10-5-2-1-3-6-10)19-12-8-4-7-11(9-12)15(17)18/h1-9H,(H,14,16) |
| InChIKey | RFUCOJNRAFBQME-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3-nitrophenyl) N-phenylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3-nitrophenyl) N-phenylcarbamothioate?
The IUPAC name of S-(3-nitrophenyl) N-phenylcarbamothioate (CID 71371517) is S-(3-nitrophenyl) N-phenylcarbamothioate.
What is the SMILES notation for S-(3-nitrophenyl) N-phenylcarbamothioate?
The canonical SMILES for S-(3-nitrophenyl) N-phenylcarbamothioate is O=C(Nc1ccccc1)Sc1cccc([N+](=O)[O-])c1.
What is the InChIKey of S-(3-nitrophenyl) N-phenylcarbamothioate?
The InChIKey is RFUCOJNRAFBQME-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O3S/c16-13(14-10-5-2-1-3-6-10)19-12-8-4-7-11(9-12)15(17)18/h1-9H,(H,14,16).
What are the key properties of S-(3-nitrophenyl) N-phenylcarbamothioate?
S-(3-nitrophenyl) N-phenylcarbamothioate has a molecular weight of 274.30 g/mol, XLogP of 3.92, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3-nitrophenyl) N-phenylcarbamothioate is sourced from PubChem (CID 71371517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).