About azane;ethene;(3-nitrophenyl)sulfanylmethanethioic S-acid
azane;ethene;(3-nitrophenyl)sulfanylmethanethioic S-acid (PubChem CID 174784405) has the molecular formula C13H23N3O3S2
and a molecular weight of 333.48 g/mol. Its IUPAC name is azane;ethene;(3-nitrophenyl)sulfanylmethanethioic S-acid.
Molecular Properties
| Compound Name | azane;ethene;(3-nitrophenyl)sulfanylmethanethioic S-acid |
| PubChem CID | 174784405 |
| Molecular Formula | C13H23N3O3S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | azane;ethene;(3-nitrophenyl)sulfanylmethanethioic S-acid |
| SMILES | C=C.C=C.C=C.N.N.O=C(S)Sc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H5NO3S2.3C2H4.2H3N/c9-7(12)13-6-3-1-2-5(4-6)8(10)11;3*1-2;;/h1-4H,(H,9,12);3*1-2H2;2*1H3 |
| InChIKey | UFQSDGJFLMJEOR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze azane;ethene;(3-nitrophenyl)sulfanylmethanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ethene;(3-nitrophenyl)sulfanylmethanethioic S-acid?
The IUPAC name of azane;ethene;(3-nitrophenyl)sulfanylmethanethioic S-acid (CID 174784405) is azane;ethene;(3-nitrophenyl)sulfanylmethanethioic S-acid.
What is the SMILES notation for azane;ethene;(3-nitrophenyl)sulfanylmethanethioic S-acid?
The canonical SMILES for azane;ethene;(3-nitrophenyl)sulfanylmethanethioic S-acid is C=C.C=C.C=C.N.N.O=C(S)Sc1cccc([N+](=O)[O-])c1.
What is the InChIKey of azane;ethene;(3-nitrophenyl)sulfanylmethanethioic S-acid?
The InChIKey is UFQSDGJFLMJEOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3S2.3C2H4.2H3N/c9-7(12)13-6-3-1-2-5(4-6)8(10)11;3*1-2;;/h1-4H,(H,9,12);3*1-2H2;2*1H3.
What are the key properties of azane;ethene;(3-nitrophenyl)sulfanylmethanethioic S-acid?
azane;ethene;(3-nitrophenyl)sulfanylmethanethioic S-acid has a molecular weight of 333.48 g/mol, XLogP of 5.47, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethene;(3-nitrophenyl)sulfanylmethanethioic S-acid is sourced from PubChem (CID 174784405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).