About S-(3-nitrophenyl) methanethioate
S-(3-nitrophenyl) methanethioate (PubChem CID 91545239) has the molecular formula C7H5NO3S
and a molecular weight of 183.19 g/mol. Its IUPAC name is S-(3-nitrophenyl) methanethioate.
Molecular Properties
| Compound Name | S-(3-nitrophenyl) methanethioate |
| PubChem CID | 91545239 |
| Molecular Formula | C7H5NO3S |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.00 |
| IUPAC Name | S-(3-nitrophenyl) methanethioate |
| SMILES | O=CSc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H5NO3S/c9-5-12-7-3-1-2-6(4-7)8(10)11/h1-5H |
| InChIKey | MCXVGBVWDYGCPA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3-nitrophenyl) methanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3-nitrophenyl) methanethioate?
The IUPAC name of S-(3-nitrophenyl) methanethioate (CID 91545239) is S-(3-nitrophenyl) methanethioate.
What is the SMILES notation for S-(3-nitrophenyl) methanethioate?
The canonical SMILES for S-(3-nitrophenyl) methanethioate is O=CSc1cccc([N+](=O)[O-])c1.
What is the InChIKey of S-(3-nitrophenyl) methanethioate?
The InChIKey is MCXVGBVWDYGCPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3S/c9-5-12-7-3-1-2-6(4-7)8(10)11/h1-5H.
What are the key properties of S-(3-nitrophenyl) methanethioate?
S-(3-nitrophenyl) methanethioate has a molecular weight of 183.19 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3-nitrophenyl) methanethioate is sourced from PubChem (CID 91545239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).