About (3-nitrophenyl)phosphane
(3-nitrophenyl)phosphane (PubChem CID 101369545) has the molecular formula C6H6NO2P
and a molecular weight of 155.09 g/mol. Its IUPAC name is (3-nitrophenyl)phosphane.
Molecular Properties
| Compound Name | (3-nitrophenyl)phosphane |
| PubChem CID | 101369545 |
| Molecular Formula | C6H6NO2P |
| Molecular Weight | 155.09 g/mol |
| Exact Mass | 155.01 |
| IUPAC Name | (3-nitrophenyl)phosphane |
| SMILES | O=[N+]([O-])c1cccc(P)c1 |
| InChI | InChI=1S/C6H6NO2P/c8-7(9)5-2-1-3-6(10)4-5/h1-4H,10H2 |
| InChIKey | OHPIZJHWSPHKOH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.09 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-nitrophenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitrophenyl)phosphane?
The IUPAC name of (3-nitrophenyl)phosphane (CID 101369545) is (3-nitrophenyl)phosphane.
What is the SMILES notation for (3-nitrophenyl)phosphane?
The canonical SMILES for (3-nitrophenyl)phosphane is O=[N+]([O-])c1cccc(P)c1.
What is the InChIKey of (3-nitrophenyl)phosphane?
The InChIKey is OHPIZJHWSPHKOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6NO2P/c8-7(9)5-2-1-3-6(10)4-5/h1-4H,10H2.
What are the key properties of (3-nitrophenyl)phosphane?
(3-nitrophenyl)phosphane has a molecular weight of 155.09 g/mol, XLogP of 1.10, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitrophenyl)phosphane is sourced from PubChem (CID 101369545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).