About 1-bromo-3-nitrobenzene;zinc
1-bromo-3-nitrobenzene;zinc (PubChem CID 159421870) has the molecular formula C6H4BrNO2Zn
and a molecular weight of 267.40 g/mol. Its IUPAC name is 1-bromo-3-nitrobenzene;zinc.
Molecular Properties
| Compound Name | 1-bromo-3-nitrobenzene;zinc |
| PubChem CID | 159421870 |
| Molecular Formula | C6H4BrNO2Zn |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 264.87 |
| IUPAC Name | 1-bromo-3-nitrobenzene;zinc |
| SMILES | O=[N+]([O-])c1cccc(Br)c1.[Zn] |
| InChI | InChI=1S/C6H4BrNO2.Zn/c7-5-2-1-3-6(4-5)8(9)10;/h1-4H; |
| InChIKey | LPWCYLAKXKAPLE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3-nitrobenzene;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-nitrobenzene;zinc?
The IUPAC name of 1-bromo-3-nitrobenzene;zinc (CID 159421870) is 1-bromo-3-nitrobenzene;zinc.
What is the SMILES notation for 1-bromo-3-nitrobenzene;zinc?
The canonical SMILES for 1-bromo-3-nitrobenzene;zinc is O=[N+]([O-])c1cccc(Br)c1.[Zn].
What is the InChIKey of 1-bromo-3-nitrobenzene;zinc?
The InChIKey is LPWCYLAKXKAPLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrNO2.Zn/c7-5-2-1-3-6(4-5)8(9)10;/h1-4H;.
What are the key properties of 1-bromo-3-nitrobenzene;zinc?
1-bromo-3-nitrobenzene;zinc has a molecular weight of 267.40 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-nitrobenzene;zinc is sourced from PubChem (CID 159421870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).