About CID 58015538
CID 58015538 (PubChem CID 58015538) has the molecular formula C7H6N2O2
and a molecular weight of 150.14 g/mol.
Molecular Properties
| Compound Name | CID 58015538 |
| PubChem CID | 58015538 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | — |
| SMILES | [CH]Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H6N2O2/c1-8-6-3-2-4-7(5-6)9(10)11/h1-5,8H |
| InChIKey | DFMUZGKASZVBIK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 58015538 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58015538?
The IUPAC name of CID 58015538 (CID 58015538) is not available.
What is the SMILES notation for CID 58015538?
The canonical SMILES for CID 58015538 is [CH]Nc1cccc([N+](=O)[O-])c1.
What is the InChIKey of CID 58015538?
The InChIKey is DFMUZGKASZVBIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2/c1-8-6-3-2-4-7(5-6)9(10)11/h1-5,8H.
What are the key properties of CID 58015538?
CID 58015538 has a molecular weight of 150.14 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58015538 is sourced from PubChem (CID 58015538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).