About ethane;methanol;N-methyl-3-nitroaniline
ethane;methanol;N-methyl-3-nitroaniline (PubChem CID 144908950) has the molecular formula C10H18N2O3
and a molecular weight of 214.26 g/mol. Its IUPAC name is ethane;methanol;N-methyl-3-nitroaniline.
Molecular Properties
| Compound Name | ethane;methanol;N-methyl-3-nitroaniline |
| PubChem CID | 144908950 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | ethane;methanol;N-methyl-3-nitroaniline |
| SMILES | CC.CNc1cccc([N+](=O)[O-])c1.CO |
| InChI | InChI=1S/C7H8N2O2.C2H6.CH4O/c1-8-6-3-2-4-7(5-6)9(10)11;2*1-2/h2-5,8H,1H3;1-2H3;2H,1H3 |
| InChIKey | RNBKAJMAZLOFLV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;methanol;N-methyl-3-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanol;N-methyl-3-nitroaniline?
The IUPAC name of ethane;methanol;N-methyl-3-nitroaniline (CID 144908950) is ethane;methanol;N-methyl-3-nitroaniline.
What is the SMILES notation for ethane;methanol;N-methyl-3-nitroaniline?
The canonical SMILES for ethane;methanol;N-methyl-3-nitroaniline is CC.CNc1cccc([N+](=O)[O-])c1.CO.
What is the InChIKey of ethane;methanol;N-methyl-3-nitroaniline?
The InChIKey is RNBKAJMAZLOFLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2.C2H6.CH4O/c1-8-6-3-2-4-7(5-6)9(10)11;2*1-2/h2-5,8H,1H3;1-2H3;2H,1H3.
What are the key properties of ethane;methanol;N-methyl-3-nitroaniline?
ethane;methanol;N-methyl-3-nitroaniline has a molecular weight of 214.26 g/mol, XLogP of 2.27, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanol;N-methyl-3-nitroaniline is sourced from PubChem (CID 144908950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).