About 1-bromo-2-nitrobenzene;1-bromo-3-nitrobenzene;pyridine
1-bromo-2-nitrobenzene;1-bromo-3-nitrobenzene;pyridine (PubChem CID 87897015) has the molecular formula C17H13Br2N3O4
and a molecular weight of 483.12 g/mol. Its IUPAC name is 1-bromo-2-nitrobenzene;1-bromo-3-nitrobenzene;pyridine.
Molecular Properties
| Compound Name | 1-bromo-2-nitrobenzene;1-bromo-3-nitrobenzene;pyridine |
| PubChem CID | 87897015 |
| Molecular Formula | C17H13Br2N3O4 |
| Molecular Weight | 483.12 g/mol |
| Exact Mass | 480.93 |
| IUPAC Name | 1-bromo-2-nitrobenzene;1-bromo-3-nitrobenzene;pyridine |
| SMILES | O=[N+]([O-])c1cccc(Br)c1.O=[N+]([O-])c1ccccc1Br.c1ccncc1 |
| InChI | InChI=1S/2C6H4BrNO2.C5H5N/c7-5-2-1-3-6(4-5)8(9)10;7-5-3-1-2-4-6(5)8(9)10;1-2-4-6-5-3-1/h2*1-4H;1-5H |
| InChIKey | IPTISQGMVUYPKI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.12 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-nitrobenzene;1-bromo-3-nitrobenzene;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-nitrobenzene;1-bromo-3-nitrobenzene;pyridine?
The IUPAC name of 1-bromo-2-nitrobenzene;1-bromo-3-nitrobenzene;pyridine (CID 87897015) is 1-bromo-2-nitrobenzene;1-bromo-3-nitrobenzene;pyridine.
What is the SMILES notation for 1-bromo-2-nitrobenzene;1-bromo-3-nitrobenzene;pyridine?
The canonical SMILES for 1-bromo-2-nitrobenzene;1-bromo-3-nitrobenzene;pyridine is O=[N+]([O-])c1cccc(Br)c1.O=[N+]([O-])c1ccccc1Br.c1ccncc1.
What is the InChIKey of 1-bromo-2-nitrobenzene;1-bromo-3-nitrobenzene;pyridine?
The InChIKey is IPTISQGMVUYPKI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H4BrNO2.C5H5N/c7-5-2-1-3-6(4-5)8(9)10;7-5-3-1-2-4-6(5)8(9)10;1-2-4-6-5-3-1/h2*1-4H;1-5H.
What are the key properties of 1-bromo-2-nitrobenzene;1-bromo-3-nitrobenzene;pyridine?
1-bromo-2-nitrobenzene;1-bromo-3-nitrobenzene;pyridine has a molecular weight of 483.12 g/mol, XLogP of 5.80, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-nitrobenzene;1-bromo-3-nitrobenzene;pyridine is sourced from PubChem (CID 87897015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).