About (3-nitrophenyl) selenohypobromite
(3-nitrophenyl) selenohypobromite (PubChem CID 134881670) has the molecular formula C6H4BrNO2Se
and a molecular weight of 280.97 g/mol. Its IUPAC name is (3-nitrophenyl) selenohypobromite.
Molecular Properties
| Compound Name | (3-nitrophenyl) selenohypobromite |
| PubChem CID | 134881670 |
| Molecular Formula | C6H4BrNO2Se |
| Molecular Weight | 280.97 g/mol |
| Exact Mass | 280.86 |
| IUPAC Name | (3-nitrophenyl) selenohypobromite |
| SMILES | O=[N+]([O-])c1cccc([Se]Br)c1 |
| InChI | InChI=1S/C6H4BrNO2Se/c7-11-6-3-1-2-5(4-6)8(9)10/h1-4H |
| InChIKey | FZMJOUQXAQKOBD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.97 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-nitrophenyl) selenohypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitrophenyl) selenohypobromite?
The IUPAC name of (3-nitrophenyl) selenohypobromite (CID 134881670) is (3-nitrophenyl) selenohypobromite.
What is the SMILES notation for (3-nitrophenyl) selenohypobromite?
The canonical SMILES for (3-nitrophenyl) selenohypobromite is O=[N+]([O-])c1cccc([Se]Br)c1.
What is the InChIKey of (3-nitrophenyl) selenohypobromite?
The InChIKey is FZMJOUQXAQKOBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrNO2Se/c7-11-6-3-1-2-5(4-6)8(9)10/h1-4H.
What are the key properties of (3-nitrophenyl) selenohypobromite?
(3-nitrophenyl) selenohypobromite has a molecular weight of 280.97 g/mol, XLogP of 1.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitrophenyl) selenohypobromite is sourced from PubChem (CID 134881670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).