About 1-fluoro-3-nitrobenzene;sulfur trioxide
1-fluoro-3-nitrobenzene;sulfur trioxide (PubChem CID 167661335) has the molecular formula C6H4FNO5S
and a molecular weight of 221.16 g/mol. Its IUPAC name is 1-fluoro-3-nitrobenzene;sulfur trioxide.
Molecular Properties
| Compound Name | 1-fluoro-3-nitrobenzene;sulfur trioxide |
| PubChem CID | 167661335 |
| Molecular Formula | C6H4FNO5S |
| Molecular Weight | 221.16 g/mol |
| Exact Mass | 220.98 |
| IUPAC Name | 1-fluoro-3-nitrobenzene;sulfur trioxide |
| SMILES | O=S(=O)=O.O=[N+]([O-])c1cccc(F)c1 |
| InChI | InChI=1S/C6H4FNO2.O3S/c7-5-2-1-3-6(4-5)8(9)10;1-4(2)3/h1-4H; |
| InChIKey | RZQSLHIVWOJQQV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 94.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.16 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-3-nitrobenzene;sulfur trioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-3-nitrobenzene;sulfur trioxide?
The IUPAC name of 1-fluoro-3-nitrobenzene;sulfur trioxide (CID 167661335) is 1-fluoro-3-nitrobenzene;sulfur trioxide.
What is the SMILES notation for 1-fluoro-3-nitrobenzene;sulfur trioxide?
The canonical SMILES for 1-fluoro-3-nitrobenzene;sulfur trioxide is O=S(=O)=O.O=[N+]([O-])c1cccc(F)c1.
What is the InChIKey of 1-fluoro-3-nitrobenzene;sulfur trioxide?
The InChIKey is RZQSLHIVWOJQQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4FNO2.O3S/c7-5-2-1-3-6(4-5)8(9)10;1-4(2)3/h1-4H;.
What are the key properties of 1-fluoro-3-nitrobenzene;sulfur trioxide?
1-fluoro-3-nitrobenzene;sulfur trioxide has a molecular weight of 221.16 g/mol, XLogP of 0.73, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-3-nitrobenzene;sulfur trioxide is sourced from PubChem (CID 167661335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).