About 3-nitrobenzenesulfinyl chloride
3-nitrobenzenesulfinyl chloride (PubChem CID 58597650) has the molecular formula C6H4ClNO3S
and a molecular weight of 205.62 g/mol. Its IUPAC name is 3-nitrobenzenesulfinyl chloride.
Molecular Properties
| Compound Name | 3-nitrobenzenesulfinyl chloride |
| PubChem CID | 58597650 |
| Molecular Formula | C6H4ClNO3S |
| Molecular Weight | 205.62 g/mol |
| Exact Mass | 204.96 |
| IUPAC Name | 3-nitrobenzenesulfinyl chloride |
| SMILES | O=[N+]([O-])c1cccc(S(=O)Cl)c1 |
| InChI | InChI=1S/C6H4ClNO3S/c7-12(11)6-3-1-2-5(4-6)8(9)10/h1-4H |
| InChIKey | RCVPQFZNIDSZEO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.62 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitrobenzenesulfinyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrobenzenesulfinyl chloride?
The IUPAC name of 3-nitrobenzenesulfinyl chloride (CID 58597650) is 3-nitrobenzenesulfinyl chloride.
What is the SMILES notation for 3-nitrobenzenesulfinyl chloride?
The canonical SMILES for 3-nitrobenzenesulfinyl chloride is O=[N+]([O-])c1cccc(S(=O)Cl)c1.
What is the InChIKey of 3-nitrobenzenesulfinyl chloride?
The InChIKey is RCVPQFZNIDSZEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNO3S/c7-12(11)6-3-1-2-5(4-6)8(9)10/h1-4H.
What are the key properties of 3-nitrobenzenesulfinyl chloride?
3-nitrobenzenesulfinyl chloride has a molecular weight of 205.62 g/mol, XLogP of 1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrobenzenesulfinyl chloride is sourced from PubChem (CID 58597650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).