About oxiran-2-ylmethyl 3-nitrobenzenesulfinate
oxiran-2-ylmethyl 3-nitrobenzenesulfinate (PubChem CID 142598067) has the molecular formula C9H9NO5S
and a molecular weight of 243.24 g/mol. Its IUPAC name is oxiran-2-ylmethyl 3-nitrobenzenesulfinate.
Molecular Properties
| Compound Name | oxiran-2-ylmethyl 3-nitrobenzenesulfinate |
| PubChem CID | 142598067 |
| Molecular Formula | C9H9NO5S |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | oxiran-2-ylmethyl 3-nitrobenzenesulfinate |
| SMILES | O=[N+]([O-])c1cccc(S(=O)OCC2CO2)c1 |
| InChI | InChI=1S/C9H9NO5S/c11-10(12)7-2-1-3-9(4-7)16(13)15-6-8-5-14-8/h1-4,8H,5-6H2 |
| InChIKey | ZEBKSUFYAQFOKP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 81.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethyl 3-nitrobenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethyl 3-nitrobenzenesulfinate?
The IUPAC name of oxiran-2-ylmethyl 3-nitrobenzenesulfinate (CID 142598067) is oxiran-2-ylmethyl 3-nitrobenzenesulfinate.
What is the SMILES notation for oxiran-2-ylmethyl 3-nitrobenzenesulfinate?
The canonical SMILES for oxiran-2-ylmethyl 3-nitrobenzenesulfinate is O=[N+]([O-])c1cccc(S(=O)OCC2CO2)c1.
What is the InChIKey of oxiran-2-ylmethyl 3-nitrobenzenesulfinate?
The InChIKey is ZEBKSUFYAQFOKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO5S/c11-10(12)7-2-1-3-9(4-7)16(13)15-6-8-5-14-8/h1-4,8H,5-6H2.
What are the key properties of oxiran-2-ylmethyl 3-nitrobenzenesulfinate?
oxiran-2-ylmethyl 3-nitrobenzenesulfinate has a molecular weight of 243.24 g/mol, XLogP of 1.03, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethyl 3-nitrobenzenesulfinate is sourced from PubChem (CID 142598067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).