About [(2R)-oxiran-2-yl]methyl 2-methyl-4-nitrobenzenesulfonate
[(2R)-oxiran-2-yl]methyl 2-methyl-4-nitrobenzenesulfonate (PubChem CID 174444574) has the molecular formula C10H11NO6S
and a molecular weight of 273.27 g/mol. Its IUPAC name is [(2R)-oxiran-2-yl]methyl 2-methyl-4-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | [(2R)-oxiran-2-yl]methyl 2-methyl-4-nitrobenzenesulfonate |
| PubChem CID | 174444574 |
| Molecular Formula | C10H11NO6S |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | [(2R)-oxiran-2-yl]methyl 2-methyl-4-nitrobenzenesulfonate |
| SMILES | Cc1cc([N+](=O)[O-])ccc1S(=O)(=O)OC[C@H]1CO1 |
| InChI | InChI=1S/C10H11NO6S/c1-7-4-8(11(12)13)2-3-10(7)18(14,15)17-6-9-5-16-9/h2-4,9H,5-6H2,1H3/t9-/m1/s1 |
| InChIKey | MCGMKWDLFGSYTA-SECBINFHSA-N |
| XLogP | 1.01 |
| TPSA | 99.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-oxiran-2-yl]methyl 2-methyl-4-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-oxiran-2-yl]methyl 2-methyl-4-nitrobenzenesulfonate?
The IUPAC name of [(2R)-oxiran-2-yl]methyl 2-methyl-4-nitrobenzenesulfonate (CID 174444574) is [(2R)-oxiran-2-yl]methyl 2-methyl-4-nitrobenzenesulfonate.
What is the SMILES notation for [(2R)-oxiran-2-yl]methyl 2-methyl-4-nitrobenzenesulfonate?
The canonical SMILES for [(2R)-oxiran-2-yl]methyl 2-methyl-4-nitrobenzenesulfonate is Cc1cc([N+](=O)[O-])ccc1S(=O)(=O)OC[C@H]1CO1.
What is the InChIKey of [(2R)-oxiran-2-yl]methyl 2-methyl-4-nitrobenzenesulfonate?
The InChIKey is MCGMKWDLFGSYTA-SECBINFHSA-N. The full InChI is InChI=1S/C10H11NO6S/c1-7-4-8(11(12)13)2-3-10(7)18(14,15)17-6-9-5-16-9/h2-4,9H,5-6H2,1H3/t9-/m1/s1.
What are the key properties of [(2R)-oxiran-2-yl]methyl 2-methyl-4-nitrobenzenesulfonate?
[(2R)-oxiran-2-yl]methyl 2-methyl-4-nitrobenzenesulfonate has a molecular weight of 273.27 g/mol, XLogP of 1.01, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-oxiran-2-yl]methyl 2-methyl-4-nitrobenzenesulfonate is sourced from PubChem (CID 174444574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).